C32H39N3O6 — CID 69344709
(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-3-[6-[4-[3-(2-oxoimidazolidin-1-yl)phenyl]but-3-ynoxy]hexyl]-1,3-oxazolidin-2-one (PubChem CID 69344709) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is (5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-3-[6-[4-[3-(2-oxoimidazolidin-1-yl)phenyl]but-3-ynoxy]hexyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-3-[6-[4-[3-(2-oxoimidazolidin-1-yl)phenyl]but-3-ynoxy]hexyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69344709 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | (5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-3-[6-[4-[3-(2-oxoimidazolidin-1-yl)phenyl]but-3-ynoxy]hexyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OCc2cc([C@@H]3CN(CCCCCCOCCC#Cc4cccc(N5CCNC5=O)c4)C(=O)O3)ccc2O1 |
| InChI | InChI=1S/C32H39N3O6/c1-32(2)39-23-26-21-25(13-14-28(26)41-32)29-22-34(31(37)40-29)16-6-3-4-7-18-38-19-8-5-10-24-11-9-12-27(20-24)35-17-15-33-30(35)36/h9,11-14,20-21,29H,3-4,6-8,15-19,22-23H2,1-2H3,(H,33,36)/t29-/m0/s1 |
| InChIKey | CVXYPOPJUOZWND-LJAQVGFWSA-N |
| XLogP | 5.37 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|