C53H62N4O5 — CID 69345077
tert-butyl 3-cyclohexyl-2-phenyl-1H-indole-6-carboxylate;3-cyclohexyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-phenylindole-6-carboxylic acid (PubChem CID 69345077) has the molecular formula C53H62N4O5 and a molecular weight of 835.10 g/mol. Its IUPAC name is tert-butyl 3-cyclohexyl-2-phenyl-1H-indole-6-carboxylate;3-cyclohexyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-phenylindole-6-carboxylic acid.
| Compound Name | tert-butyl 3-cyclohexyl-2-phenyl-1H-indole-6-carboxylate;3-cyclohexyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-phenylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 69345077 |
| Molecular Formula | C53H62N4O5 |
| Molecular Weight | 835.10 g/mol |
| Exact Mass | 834.47 |
| IUPAC Name | tert-butyl 3-cyclohexyl-2-phenyl-1H-indole-6-carboxylate;3-cyclohexyl-1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-2-phenylindole-6-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3)[nH]c2c1.CN1CCN(C(=O)Cn2c(-c3ccccc3)c(C3CCCCC3)c3ccc(C(=O)O)cc32)CC1 |
| InChI | InChI=1S/C28H33N3O3.C25H29NO2/c1-29-14-16-30(17-15-29)25(32)19-31-24-18-22(28(33)34)12-13-23(24)26(20-8-4-2-5-9-20)27(31)21-10-6-3-7-11-21;1-25(2,3)28-24(27)19-14-15-20-21(16-19)26-23(18-12-8-5-9-13-18)22(20)17-10-6-4-7-11-17/h3,6-7,10-13,18,20H,2,4-5,8-9,14-17,19H2,1H3,(H,33,34);5,8-9,12-17,26H,4,6-7,10-11H2,1-3H3 |
| InChIKey | QDBFPIYIMBVNDH-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.10 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |