C14H12N2O6 — CID 69345093
6,6-dihydroxy-3-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarboxylic acid (PubChem CID 69345093) has the molecular formula C14H12N2O6 and a molecular weight of 304.26 g/mol. Its IUPAC name is 6,6-dihydroxy-3-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarboxylic acid.
| Compound Name | 6,6-dihydroxy-3-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 69345093 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 6,6-dihydroxy-3-phenyldiazenylcyclohexa-2,4-diene-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)C=C(/N=N/c2ccccc2)C=CC1(O)O |
| InChI | InChI=1S/C14H12N2O6/c17-11(18)13(12(19)20)8-10(6-7-14(13,21)22)16-15-9-4-2-1-3-5-9/h1-8,21-22H,(H,17,18)(H,19,20)/b16-15+ |
| InChIKey | MVTNWEZWFNFVFE-FOCLMDBBSA-N |
| XLogP | 1.06 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|