About 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one
2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one (PubChem CID 69345266) has the molecular formula C16H23NOS
and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one.
Molecular Properties
| Compound Name | 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one |
| PubChem CID | 69345266 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one |
| SMILES | O=C1CCCCCCCSc2cccc(c2)CCN1 |
| InChI | InChI=1S/C16H23NOS/c18-16-9-4-2-1-3-5-12-19-15-8-6-7-14(13-15)10-11-17-16/h6-8,13H,1-5,9-12H2,(H,17,18) |
| InChIKey | JACOSLDLGYAMSJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one?
The IUPAC name of 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one (CID 69345266) is 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one.
What is the SMILES notation for 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one?
The canonical SMILES for 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one is O=C1CCCCCCCSc2cccc(c2)CCN1.
What is the InChIKey of 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one?
The InChIKey is JACOSLDLGYAMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NOS/c18-16-9-4-2-1-3-5-12-19-15-8-6-7-14(13-15)10-11-17-16/h6-8,13H,1-5,9-12H2,(H,17,18).
What are the key properties of 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one?
2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one has a molecular weight of 277.43 g/mol, XLogP of 3.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thia-11-azabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-10-one is sourced from PubChem (CID 69345266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).