C11H10N2 — CID 69345662
1,4-diazatricyclo[7.3.1.05,13]trideca-2,4,7,9(13),10-pentaene (PubChem CID 69345662) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 1,4-diazatricyclo[7.3.1.05,13]trideca-2,4,7,9(13),10-pentaene.
| Compound Name | 1,4-diazatricyclo[7.3.1.05,13]trideca-2,4,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 69345662 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1,4-diazatricyclo[7.3.1.05,13]trideca-2,4,7,9(13),10-pentaene |
| SMILES | C1=CC2=C3C(=NC=CN3CC=C2)C1 |
| InChI | InChI=1S/C11H10N2/c1-3-9-4-2-7-13-8-6-12-10(5-1)11(9)13/h1-4,6,8H,5,7H2 |
| InChIKey | GSHCOJOSNPNLLX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |