C15H15FN2O4 — CID 69345745
methyl 8-fluoro-10-oxo-11-prop-2-enoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate (PubChem CID 69345745) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is methyl 8-fluoro-10-oxo-11-prop-2-enoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate.
| Compound Name | methyl 8-fluoro-10-oxo-11-prop-2-enoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 69345745 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl 8-fluoro-10-oxo-11-prop-2-enoxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxylate |
| SMILES | C=CCON1C(=O)N2CC1c1ccccc1C2(F)C(=O)OC |
| InChI | InChI=1S/C15H15FN2O4/c1-3-8-22-18-12-9-17(14(18)20)15(16,13(19)21-2)11-7-5-4-6-10(11)12/h3-7,12H,1,8-9H2,2H3 |
| InChIKey | JEKYGVOJNBPRIC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|