C11H12N2O6S — CID 69345813
[(1S,8R)-8-(hydroxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate (PubChem CID 69345813) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is [(1S,8R)-8-(hydroxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate.
| Compound Name | [(1S,8R)-8-(hydroxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 69345813 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [(1S,8R)-8-(hydroxymethyl)-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
| SMILES | O=C1N2C[C@H](c3ccccc3[C@@H]2CO)N1OS(=O)(=O)O |
| InChI | InChI=1S/C11H12N2O6S/c14-6-10-8-4-2-1-3-7(8)9-5-12(10)11(15)13(9)19-20(16,17)18/h1-4,9-10,14H,5-6H2,(H,16,17,18)/t9-,10+/m1/s1 |
| InChIKey | VWSDGNURRLFEHM-ZJUUUORDSA-N |
| XLogP | 0.25 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|