C23H27FN2O3S — CID 69345994
2-(1-fluorobutyl)-1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one (PubChem CID 69345994) has the molecular formula C23H27FN2O3S and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-(1-fluorobutyl)-1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one.
| Compound Name | 2-(1-fluorobutyl)-1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 69345994 |
| Molecular Formula | C23H27FN2O3S |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(1-fluorobutyl)-1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-1,2-thiazol-3-one |
| SMILES | CCCC(F)N1C(=O)C(NCCCCc2ccccc2)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C23H27FN2O3S/c1-2-11-20(24)26-23(27)21(22(30(26,28)29)19-15-7-4-8-16-19)25-17-10-9-14-18-12-5-3-6-13-18/h3-8,12-13,15-16,20,25H,2,9-11,14,17H2,1H3 |
| InChIKey | KHTCAOUXYNPHQJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|