About (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene
(8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene (PubChem CID 69346340) has the molecular formula C10H11FO
and a molecular weight of 166.20 g/mol. Its IUPAC name is (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene.
Analyze (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene?
The IUPAC name of (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene (CID 69346340) is (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene.
What is the SMILES notation for (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene?
The canonical SMILES for (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene is F/C=C1\C=CCC2=C1OCCC2.
What is the InChIKey of (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene?
The InChIKey is ZCHXXPNZBVJTKD-VQHVLOKHSA-N. The full InChI is InChI=1S/C10H11FO/c11-7-9-4-1-3-8-5-2-6-12-10(8)9/h1,4,7H,2-3,5-6H2/b9-7+.
What are the key properties of (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene?
(8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene has a molecular weight of 166.20 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8E)-8-(fluoromethylidene)-2,3,4,5-tetrahydrochromene is sourced from PubChem (CID 69346340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).