C16H16Cl3N3O2 — CID 69346368
2-[2-(3,5-diethoxyphenyl)ethenyl]-4-(trichloromethyl)-1,3,5-triazine (PubChem CID 69346368) has the molecular formula C16H16Cl3N3O2 and a molecular weight of 388.68 g/mol. Its IUPAC name is 2-[2-(3,5-diethoxyphenyl)ethenyl]-4-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[2-(3,5-diethoxyphenyl)ethenyl]-4-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 69346368 |
| Molecular Formula | C16H16Cl3N3O2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[2-(3,5-diethoxyphenyl)ethenyl]-4-(trichloromethyl)-1,3,5-triazine |
| SMILES | CCOc1cc(C=Cc2ncnc(C(Cl)(Cl)Cl)n2)cc(OCC)c1 |
| InChI | InChI=1S/C16H16Cl3N3O2/c1-3-23-12-7-11(8-13(9-12)24-4-2)5-6-14-20-10-21-15(22-14)16(17,18)19/h5-10H,3-4H2,1-2H3 |
| InChIKey | GLOIMLRWEQTPBJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|