C11H11N3O6S — CID 69346516
[(1S,8R)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate (PubChem CID 69346516) has the molecular formula C11H11N3O6S and a molecular weight of 313.29 g/mol. Its IUPAC name is [(1S,8R)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate.
| Compound Name | [(1S,8R)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 69346516 |
| Molecular Formula | C11H11N3O6S |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | [(1S,8R)-8-carbamoyl-10-oxo-9,11-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-11-yl] hydrogen sulfate |
| SMILES | NC(=O)[C@H]1c2ccccc2[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H11N3O6S/c12-10(15)9-7-4-2-1-3-6(7)8-5-13(9)11(16)14(8)20-21(17,18)19/h1-4,8-9H,5H2,(H2,12,15)(H,17,18,19)/t8-,9-/m1/s1 |
| InChIKey | RGKCMOXBUPOTQU-RKDXNWHRSA-N |
| XLogP | -0.26 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|