C11H10Cl2F2N4O3S — CID 69346548
1,1-dichloro-N-[3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide (PubChem CID 69346548) has the molecular formula C11H10Cl2F2N4O3S and a molecular weight of 387.20 g/mol. Its IUPAC name is 1,1-dichloro-N-[3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide.
| Compound Name | 1,1-dichloro-N-[3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 69346548 |
| Molecular Formula | C11H10Cl2F2N4O3S |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1,1-dichloro-N-[3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1nn(-c2cccc(NS(=O)(=O)C(Cl)Cl)c2)c(=O)n1C(F)F |
| InChI | InChI=1S/C11H10Cl2F2N4O3S/c1-6-16-19(11(20)18(6)10(14)15)8-4-2-3-7(5-8)17-23(21,22)9(12)13/h2-5,9-10,17H,1H3 |
| InChIKey | USLKPBQPSHLFSJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|