About 2-butyl-4-chlorophenol;4-chloro-2-methylphenol
2-butyl-4-chlorophenol;4-chloro-2-methylphenol (PubChem CID 69346609) has the molecular formula C17H20Cl2O2
and a molecular weight of 327.25 g/mol. Its IUPAC name is 2-butyl-4-chlorophenol;4-chloro-2-methylphenol.
Molecular Properties
| Compound Name | 2-butyl-4-chlorophenol;4-chloro-2-methylphenol |
| PubChem CID | 69346609 |
| Molecular Formula | C17H20Cl2O2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-butyl-4-chlorophenol;4-chloro-2-methylphenol |
| SMILES | CCCCc1cc(Cl)ccc1O.Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H13ClO.C7H7ClO/c1-2-3-4-8-7-9(11)5-6-10(8)12;1-5-4-6(8)2-3-7(5)9/h5-7,12H,2-4H2,1H3;2-4,9H,1H3 |
| InChIKey | VVGUQNURTRPFBK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-4-chlorophenol;4-chloro-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4-chlorophenol;4-chloro-2-methylphenol?
The IUPAC name of 2-butyl-4-chlorophenol;4-chloro-2-methylphenol (CID 69346609) is 2-butyl-4-chlorophenol;4-chloro-2-methylphenol.
What is the SMILES notation for 2-butyl-4-chlorophenol;4-chloro-2-methylphenol?
The canonical SMILES for 2-butyl-4-chlorophenol;4-chloro-2-methylphenol is CCCCc1cc(Cl)ccc1O.Cc1cc(Cl)ccc1O.
What is the InChIKey of 2-butyl-4-chlorophenol;4-chloro-2-methylphenol?
The InChIKey is VVGUQNURTRPFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO.C7H7ClO/c1-2-3-4-8-7-9(11)5-6-10(8)12;1-5-4-6(8)2-3-7(5)9/h5-7,12H,2-4H2,1H3;2-4,9H,1H3.
What are the key properties of 2-butyl-4-chlorophenol;4-chloro-2-methylphenol?
2-butyl-4-chlorophenol;4-chloro-2-methylphenol has a molecular weight of 327.25 g/mol, XLogP of 5.74, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4-chlorophenol;4-chloro-2-methylphenol is sourced from PubChem (CID 69346609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).