C15H16N2S — CID 69347207
2,3-dihydro-1,3-benzothiazole;2,3-dihydro-1H-isoindole (PubChem CID 69347207) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2,3-dihydro-1,3-benzothiazole;2,3-dihydro-1H-isoindole.
| Compound Name | 2,3-dihydro-1,3-benzothiazole;2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 69347207 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2,3-dihydro-1,3-benzothiazole;2,3-dihydro-1H-isoindole |
| SMILES | c1ccc2c(c1)CNC2.c1ccc2c(c1)NCS2 |
| InChI | InChI=1S/C8H9N.C7H7NS/c1-2-4-8-6-9-5-7(8)3-1;1-2-4-7-6(3-1)8-5-9-7/h1-4,9H,5-6H2;1-4,8H,5H2 |
| InChIKey | PDMCVNDVUGNHDS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |