C21H28O3 — CID 69347444
[(8R,9S,10R,11S,13S,14S)-11,13-dimethyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 69347444) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is [(8R,9S,10R,11S,13S,14S)-11,13-dimethyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(8R,9S,10R,11S,13S,14S)-11,13-dimethyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 69347444 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | [(8R,9S,10R,11S,13S,14S)-11,13-dimethyl-3-oxo-2,8,9,10,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2C(=CC1=O)C=C[C@@H]1[C@@H]2[C@@H](C)C[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C21H28O3/c1-12-11-21(3)8-4-5-17(21)15-7-6-14-9-18(23)19(24-13(2)22)10-16(14)20(12)15/h6-7,9,12,15-17,19-20H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19?,20-,21-/m0/s1 |
| InChIKey | MOUJAKBMJNAFCX-LJVQKQDNSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |