About 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one
6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one (PubChem CID 69347590) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one.
Molecular Properties
| Compound Name | 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one |
| PubChem CID | 69347590 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one |
| SMILES | CCN1C(=O)CC(C)(C)c2cc(N)c(N)cc21 |
| InChI | InChI=1S/C13H19N3O/c1-4-16-11-6-10(15)9(14)5-8(11)13(2,3)7-12(16)17/h5-6H,4,7,14-15H2,1-3H3 |
| InChIKey | AMODFSSWHRVKQI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one?
The IUPAC name of 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one (CID 69347590) is 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one.
What is the SMILES notation for 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one?
The canonical SMILES for 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one is CCN1C(=O)CC(C)(C)c2cc(N)c(N)cc21.
What is the InChIKey of 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one?
The InChIKey is AMODFSSWHRVKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-4-16-11-6-10(15)9(14)5-8(11)13(2,3)7-12(16)17/h5-6H,4,7,14-15H2,1-3H3.
What are the key properties of 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one?
6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one has a molecular weight of 233.31 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-diamino-1-ethyl-4,4-dimethyl-3H-quinolin-2-one is sourced from PubChem (CID 69347590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).