C28H32F3N7O4 — CID 69347926
1-[4-[[[5-nitro-2-[N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]anilino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-ol (PubChem CID 69347926) has the molecular formula C28H32F3N7O4 and a molecular weight of 587.60 g/mol. Its IUPAC name is 1-[4-[[[5-nitro-2-[N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]anilino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-ol.
| Compound Name | 1-[4-[[[5-nitro-2-[N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]anilino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-ol |
|---|---|
| PubChem CID | 69347926 |
| Molecular Formula | C28H32F3N7O4 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 1-[4-[[[5-nitro-2-[N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]anilino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-ol |
| SMILES | O=[N+]([O-])c1cnc(N(Cc2cccnc2OCC(F)(F)F)c2ccccc2)nc1NCC1CCC(N2CC(O)C2)CC1 |
| InChI | InChI=1S/C28H32F3N7O4/c29-28(30,31)18-42-26-20(5-4-12-32-26)15-37(22-6-2-1-3-7-22)27-34-14-24(38(40)41)25(35-27)33-13-19-8-10-21(11-9-19)36-16-23(39)17-36/h1-7,12,14,19,21,23,39H,8-11,13,15-18H2,(H,33,34,35) |
| InChIKey | FQELLNKOTMLXHM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|