About cyclopenta[d]triazole
cyclopenta[d]triazole (PubChem CID 69348047) has the molecular formula C5H3N3
and a molecular weight of 105.10 g/mol. Its IUPAC name is cyclopenta[d]triazole.
Molecular Properties
| Compound Name | cyclopenta[d]triazole |
| PubChem CID | 69348047 |
| Molecular Formula | C5H3N3 |
| Molecular Weight | 105.10 g/mol |
| Exact Mass | 105.03 |
| IUPAC Name | cyclopenta[d]triazole |
| SMILES | C1=CC2=NN=NC2=C1 |
| InChI | InChI=1S/C5H3N3/c1-2-4-5(3-1)7-8-6-4/h1-3H |
| InChIKey | IZJPDMAOXFNGNK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.10 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopenta[d]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[d]triazole?
The IUPAC name of cyclopenta[d]triazole (CID 69348047) is cyclopenta[d]triazole.
What is the SMILES notation for cyclopenta[d]triazole?
The canonical SMILES for cyclopenta[d]triazole is C1=CC2=NN=NC2=C1.
What is the InChIKey of cyclopenta[d]triazole?
The InChIKey is IZJPDMAOXFNGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3/c1-2-4-5(3-1)7-8-6-4/h1-3H.
What are the key properties of cyclopenta[d]triazole?
cyclopenta[d]triazole has a molecular weight of 105.10 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[d]triazole is sourced from PubChem (CID 69348047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).