C16H14O5 — CID 69348261
[(2R,4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromen-6-yl] hydrogen carbonate (PubChem CID 69348261) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is [(2R,4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromen-6-yl] hydrogen carbonate.
| Compound Name | [(2R,4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromen-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 69348261 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [(2R,4R)-2-hydroxy-4-phenyl-3,4-dihydro-2H-chromen-6-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2c(c1)[C@@H](c1ccccc1)C[C@H](O)O2 |
| InChI | InChI=1S/C16H14O5/c17-15-9-12(10-4-2-1-3-5-10)13-8-11(20-16(18)19)6-7-14(13)21-15/h1-8,12,15,17H,9H2,(H,18,19)/t12-,15-/m1/s1 |
| InChIKey | GUUJQEICROURBT-IUODEOHRSA-N |
| XLogP | 2.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|