C14H25NO5Si — CID 69348864
(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid (PubChem CID 69348864) has the molecular formula C14H25NO5Si and a molecular weight of 315.44 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid.
| Compound Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 69348864 |
| Molecular Formula | C14H25NO5Si |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CC(C(=O)O)=CCN1C(=O)O |
| InChI | InChI=1S/C14H25NO5Si/c1-14(2,3)21(4,5)20-9-11-8-10(12(16)17)6-7-15(11)13(18)19/h6,11H,7-9H2,1-5H3,(H,16,17)(H,18,19)/t11-/m1/s1 |
| InChIKey | RZDSJFYRVLLVRB-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|