C10H11ClN2O2S2 — CID 69349671
(2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 69349671) has the molecular formula C10H11ClN2O2S2 and a molecular weight of 290.80 g/mol. Its IUPAC name is (2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | (2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 69349671 |
| Molecular Formula | C10H11ClN2O2S2 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | (2S)-2-(chloromethyl)-4-(2-sulfanylidene-3H-1,3-thiazol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CC=C(c2csc(=S)[nH]2)C[C@H]1CCl |
| InChI | InChI=1S/C10H11ClN2O2S2/c11-4-7-3-6(1-2-13(7)10(14)15)8-5-17-9(16)12-8/h1,5,7H,2-4H2,(H,12,16)(H,14,15)/t7-/m0/s1 |
| InChIKey | TVSMXRQNPUGRMJ-ZETCQYMHSA-N |
| XLogP | 3.18 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|