About oxet-2-one;trimethoxy(methyl)silane
oxet-2-one;trimethoxy(methyl)silane (PubChem CID 69350131) has the molecular formula C7H14O5Si
and a molecular weight of 206.27 g/mol. Its IUPAC name is oxet-2-one;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | oxet-2-one;trimethoxy(methyl)silane |
| PubChem CID | 69350131 |
| Molecular Formula | C7H14O5Si |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | oxet-2-one;trimethoxy(methyl)silane |
| SMILES | CO[Si](C)(OC)OC.O=C1C=CO1 |
| InChI | InChI=1S/C4H12O3Si.C3H2O2/c1-5-8(4,6-2)7-3;4-3-1-2-5-3/h1-4H3;1-2H |
| InChIKey | QYVKNWCGUQALHF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxet-2-one;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxet-2-one;trimethoxy(methyl)silane?
The IUPAC name of oxet-2-one;trimethoxy(methyl)silane (CID 69350131) is oxet-2-one;trimethoxy(methyl)silane.
What is the SMILES notation for oxet-2-one;trimethoxy(methyl)silane?
The canonical SMILES for oxet-2-one;trimethoxy(methyl)silane is CO[Si](C)(OC)OC.O=C1C=CO1.
What is the InChIKey of oxet-2-one;trimethoxy(methyl)silane?
The InChIKey is QYVKNWCGUQALHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O3Si.C3H2O2/c1-5-8(4,6-2)7-3;4-3-1-2-5-3/h1-4H3;1-2H.
What are the key properties of oxet-2-one;trimethoxy(methyl)silane?
oxet-2-one;trimethoxy(methyl)silane has a molecular weight of 206.27 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxet-2-one;trimethoxy(methyl)silane is sourced from PubChem (CID 69350131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).