About (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid
(2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid (PubChem CID 69350167) has the molecular formula C8H10FNO4
and a molecular weight of 203.17 g/mol. Its IUPAC name is (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
| PubChem CID | 69350167 |
| Molecular Formula | C8H10FNO4 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1=CCN(C(=O)O)[C@H](CF)C1 |
| InChI | InChI=1S/C8H10FNO4/c9-4-6-3-5(7(11)12)1-2-10(6)8(13)14/h1,6H,2-4H2,(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | AVJRTRQSZYPMRX-LURJTMIESA-N |
| XLogP | 0.72 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid?
The IUPAC name of (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid (CID 69350167) is (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid.
What is the SMILES notation for (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid?
The canonical SMILES for (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid is O=C(O)C1=CCN(C(=O)O)[C@H](CF)C1.
What is the InChIKey of (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid?
The InChIKey is AVJRTRQSZYPMRX-LURJTMIESA-N. The full InChI is InChI=1S/C8H10FNO4/c9-4-6-3-5(7(11)12)1-2-10(6)8(13)14/h1,6H,2-4H2,(H,11,12)(H,13,14)/t6-/m0/s1.
What are the key properties of (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid?
(2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid has a molecular weight of 203.17 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(fluoromethyl)-3,6-dihydro-2H-pyridine-1,4-dicarboxylic acid is sourced from PubChem (CID 69350167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).