About 1,2,4-triazol-1-yl acetate
1,2,4-triazol-1-yl acetate (PubChem CID 69350872) has the molecular formula C4H5N3O2
and a molecular weight of 127.10 g/mol. Its IUPAC name is 1,2,4-triazol-1-yl acetate.
Molecular Properties
| Compound Name | 1,2,4-triazol-1-yl acetate |
| PubChem CID | 69350872 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 1,2,4-triazol-1-yl acetate |
| SMILES | CC(=O)On1cncn1 |
| InChI | InChI=1S/C4H5N3O2/c1-4(8)9-7-3-5-2-6-7/h2-3H,1H3 |
| InChIKey | HZGXTVSNRKIAJM-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2,4-triazol-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-triazol-1-yl acetate?
The IUPAC name of 1,2,4-triazol-1-yl acetate (CID 69350872) is 1,2,4-triazol-1-yl acetate.
What is the SMILES notation for 1,2,4-triazol-1-yl acetate?
The canonical SMILES for 1,2,4-triazol-1-yl acetate is CC(=O)On1cncn1.
What is the InChIKey of 1,2,4-triazol-1-yl acetate?
The InChIKey is HZGXTVSNRKIAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c1-4(8)9-7-3-5-2-6-7/h2-3H,1H3.
What are the key properties of 1,2,4-triazol-1-yl acetate?
1,2,4-triazol-1-yl acetate has a molecular weight of 127.10 g/mol, XLogP of -0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-triazol-1-yl acetate is sourced from PubChem (CID 69350872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).