About 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one
4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one (PubChem CID 69350923) has the molecular formula C10H9BrF2O2
and a molecular weight of 279.08 g/mol. Its IUPAC name is 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one.
Molecular Properties
| Compound Name | 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one |
| PubChem CID | 69350923 |
| Molecular Formula | C10H9BrF2O2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one |
| SMILES | COC1=CC(F)(F)C(Br)C2=C1C(=O)CC2 |
| InChI | InChI=1S/C10H9BrF2O2/c1-15-7-4-10(12,13)9(11)5-2-3-6(14)8(5)7/h4,9H,2-3H2,1H3 |
| InChIKey | AJFLOUVUWPLRPF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one?
The IUPAC name of 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one (CID 69350923) is 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one.
What is the SMILES notation for 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one?
The canonical SMILES for 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one is COC1=CC(F)(F)C(Br)C2=C1C(=O)CC2.
What is the InChIKey of 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one?
The InChIKey is AJFLOUVUWPLRPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O2/c1-15-7-4-10(12,13)9(11)5-2-3-6(14)8(5)7/h4,9H,2-3H2,1H3.
What are the key properties of 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one?
4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one has a molecular weight of 279.08 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5,5-difluoro-7-methoxy-3,4-dihydro-2H-inden-1-one is sourced from PubChem (CID 69350923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).