C23H32O5 — CID 69351674
methyl 2-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]hept-5-enoate (PubChem CID 69351674) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is methyl 2-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl 2-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 69351674 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl 2-[(1R,2S,3R)-3-hydroxy-2-[4-(1-hydroxy-2-methylpropan-2-yl)phenyl]-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC=CCCC(C(=O)OC)[C@@H]1C(=O)C[C@@H](O)[C@@H]1c1ccc(C(C)(C)CO)cc1 |
| InChI | InChI=1S/C23H32O5/c1-5-6-7-8-17(22(27)28-4)21-19(26)13-18(25)20(21)15-9-11-16(12-10-15)23(2,3)14-24/h5-6,9-12,17-18,20-21,24-25H,7-8,13-14H2,1-4H3/t17?,18-,20+,21-/m1/s1 |
| InChIKey | ONBDNPIBSWPTHK-VCCAVGLWSA-N |
| XLogP | 3.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|