About (3R)-3-aminopiperidine-2,6-dione;hydrobromide
(3R)-3-aminopiperidine-2,6-dione;hydrobromide (PubChem CID 69352156) has the molecular formula C5H9BrN2O2
and a molecular weight of 209.04 g/mol. Its IUPAC name is (3R)-3-aminopiperidine-2,6-dione;hydrobromide.
Molecular Properties
| Compound Name | (3R)-3-aminopiperidine-2,6-dione;hydrobromide |
| PubChem CID | 69352156 |
| Molecular Formula | C5H9BrN2O2 |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | (3R)-3-aminopiperidine-2,6-dione;hydrobromide |
| SMILES | Br.N[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O2.BrH/c6-3-1-2-4(8)7-5(3)9;/h3H,1-2,6H2,(H,7,8,9);1H/t3-;/m1./s1 |
| InChIKey | PWGRLXLAQOHQKX-AENDTGMFSA-N |
| XLogP | -0.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-aminopiperidine-2,6-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-aminopiperidine-2,6-dione;hydrobromide?
The IUPAC name of (3R)-3-aminopiperidine-2,6-dione;hydrobromide (CID 69352156) is (3R)-3-aminopiperidine-2,6-dione;hydrobromide.
What is the SMILES notation for (3R)-3-aminopiperidine-2,6-dione;hydrobromide?
The canonical SMILES for (3R)-3-aminopiperidine-2,6-dione;hydrobromide is Br.N[C@@H]1CCC(=O)NC1=O.
What is the InChIKey of (3R)-3-aminopiperidine-2,6-dione;hydrobromide?
The InChIKey is PWGRLXLAQOHQKX-AENDTGMFSA-N. The full InChI is InChI=1S/C5H8N2O2.BrH/c6-3-1-2-4(8)7-5(3)9;/h3H,1-2,6H2,(H,7,8,9);1H/t3-;/m1./s1.
What are the key properties of (3R)-3-aminopiperidine-2,6-dione;hydrobromide?
(3R)-3-aminopiperidine-2,6-dione;hydrobromide has a molecular weight of 209.04 g/mol, XLogP of -0.67, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-aminopiperidine-2,6-dione;hydrobromide is sourced from PubChem (CID 69352156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).