About CID 69352573
CID 69352573 (PubChem CID 69352573) has the molecular formula C37H48ClN2O7Si
and a molecular weight of 696.34 g/mol.
Molecular Properties
| Compound Name | CID 69352573 |
| PubChem CID | 69352573 |
| Molecular Formula | C37H48ClN2O7Si |
| Molecular Weight | 696.34 g/mol |
| Exact Mass | 695.29 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CCC(=O)N(c1ccc(Cl)cc1Oc1cccc(CNC(=O)OC(C)(C)C)c1)C(O[Si](C)C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H48ClN2O7Si/c1-10-44-33(42)21-20-32(41)40(34(47-48(8)9)26-14-16-27(17-15-26)36(2,3)4)30-19-18-28(38)23-31(30)45-29-13-11-12-25(22-29)24-39-35(43)46-37(5,6)7/h11-19,22-23,34H,10,20-21,24H2,1-9H3,(H,39,43) |
| InChIKey | VFCDCUQKWQGZCI-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 696.34 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 69352573 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69352573?
The IUPAC name of CID 69352573 (CID 69352573) is not available.
What is the SMILES notation for CID 69352573?
The canonical SMILES for CID 69352573 is CCOC(=O)CCC(=O)N(c1ccc(Cl)cc1Oc1cccc(CNC(=O)OC(C)(C)C)c1)C(O[Si](C)C)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of CID 69352573?
The InChIKey is VFCDCUQKWQGZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H48ClN2O7Si/c1-10-44-33(42)21-20-32(41)40(34(47-48(8)9)26-14-16-27(17-15-26)36(2,3)4)30-19-18-28(38)23-31(30)45-29-13-11-12-25(22-29)24-39-35(43)46-37(5,6)7/h11-19,22-23,34H,10,20-21,24H2,1-9H3,(H,39,43).
What are the key properties of CID 69352573?
CID 69352573 has a molecular weight of 696.34 g/mol, XLogP of 9.10, 13 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69352573 is sourced from PubChem (CID 69352573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).