C31H33F2NO6 — CID 69352585
(3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-[4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one (PubChem CID 69352585) has the molecular formula C31H33F2NO6 and a molecular weight of 553.60 g/mol. Its IUPAC name is (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-[4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one.
| Compound Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-[4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 69352585 |
| Molecular Formula | C31H33F2NO6 |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)propyl]-4-[4-[[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]phenyl]azetidin-2-one |
| SMILES | O=C1[C@H](CCCc2ccc(F)cc2)[C@@H](c2ccc(C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C31H33F2NO6/c32-21-10-6-18(7-11-21)2-1-3-24-27(34(31(24)39)23-14-12-22(33)13-15-23)20-8-4-19(5-9-20)16-25-28(36)30(38)29(37)26(17-35)40-25/h4-15,24-30,35-38H,1-3,16-17H2/t24-,25-,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | NKQASEZQXKMSRC-XUGCRXJHSA-N |
| XLogP | 3.08 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |