About 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide
4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide (PubChem CID 69352942) has the molecular formula C18H20ClF2N3O3
and a molecular weight of 399.83 g/mol. Its IUPAC name is 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide.
Molecular Properties
| Compound Name | 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide |
| PubChem CID | 69352942 |
| Molecular Formula | C18H20ClF2N3O3 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide |
| SMILES | CC(C)n1c(CCCC(N)=O)nc(OCc2ccc(F)cc2F)c(Cl)c1=O |
| InChI | InChI=1S/C18H20ClF2N3O3/c1-10(2)24-15(5-3-4-14(22)25)23-17(16(19)18(24)26)27-9-11-6-7-12(20)8-13(11)21/h6-8,10H,3-5,9H2,1-2H3,(H2,22,25) |
| InChIKey | JVBBZACCZJMKCK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide?
The IUPAC name of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide (CID 69352942) is 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide.
What is the SMILES notation for 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide?
The canonical SMILES for 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide is CC(C)n1c(CCCC(N)=O)nc(OCc2ccc(F)cc2F)c(Cl)c1=O.
What is the InChIKey of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide?
The InChIKey is JVBBZACCZJMKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClF2N3O3/c1-10(2)24-15(5-3-4-14(22)25)23-17(16(19)18(24)26)27-9-11-6-7-12(20)8-13(11)21/h6-8,10H,3-5,9H2,1-2H3,(H2,22,25).
What are the key properties of 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide?
4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide has a molecular weight of 399.83 g/mol, XLogP of 3.14, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-chloro-4-[(2,4-difluorophenyl)methoxy]-6-oxo-1-propan-2-ylpyrimidin-2-yl]butanamide is sourced from PubChem (CID 69352942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).