C17H15ClO3 — CID 69353136
(1S,12S)-4-chloro-10-ethyl-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraene-2,11-dione (PubChem CID 69353136) has the molecular formula C17H15ClO3 and a molecular weight of 302.76 g/mol. Its IUPAC name is (1S,12S)-4-chloro-10-ethyl-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraene-2,11-dione.
| Compound Name | (1S,12S)-4-chloro-10-ethyl-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraene-2,11-dione |
|---|---|
| PubChem CID | 69353136 |
| Molecular Formula | C17H15ClO3 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (1S,12S)-4-chloro-10-ethyl-5-hydroxytetracyclo[10.2.1.01,9.03,8]pentadeca-3(8),4,6,9-tetraene-2,11-dione |
| SMILES | CCC1=C2c3ccc(O)c(Cl)c3C(=O)[C@]23CC[C@@H](C3)C1=O |
| InChI | InChI=1S/C17H15ClO3/c1-2-9-13-10-3-4-11(19)14(18)12(10)16(21)17(13)6-5-8(7-17)15(9)20/h3-4,8,19H,2,5-7H2,1H3/t8-,17-/m0/s1 |
| InChIKey | JSQIKNZEUPXWAN-QPFGOUBPSA-N |
| XLogP | 3.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |