C25H26F3N3O — CID 69353177
5-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-ylidene]methyl]-2-(trifluoromethyl)aniline (PubChem CID 69353177) has the molecular formula C25H26F3N3O and a molecular weight of 441.50 g/mol. Its IUPAC name is 5-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-ylidene]methyl]-2-(trifluoromethyl)aniline.
| Compound Name | 5-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-ylidene]methyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 69353177 |
| Molecular Formula | C25H26F3N3O |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 5-[[1-[2-(2-methylquinolin-5-yl)oxyethyl]piperidin-4-ylidene]methyl]-2-(trifluoromethyl)aniline |
| SMILES | Cc1ccc2c(OCCN3CCC(=Cc4ccc(C(F)(F)F)c(N)c4)CC3)cccc2n1 |
| InChI | InChI=1S/C25H26F3N3O/c1-17-5-7-20-23(30-17)3-2-4-24(20)32-14-13-31-11-9-18(10-12-31)15-19-6-8-21(22(29)16-19)25(26,27)28/h2-8,15-16H,9-14,29H2,1H3 |
| InChIKey | ONXLHKGUPLASPB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|