C38H47N5O3Si — CID 69353514
N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[[3-[2-(4,6-dimethyl-2-pyridinyl)ethenyl]-1-(oxan-2-yl)indazol-6-yl]amino]benzamide (PubChem CID 69353514) has the molecular formula C38H47N5O3Si and a molecular weight of 649.91 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[[3-[2-(4,6-dimethyl-2-pyridinyl)ethenyl]-1-(oxan-2-yl)indazol-6-yl]amino]benzamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[[3-[2-(4,6-dimethyl-2-pyridinyl)ethenyl]-1-(oxan-2-yl)indazol-6-yl]amino]benzamide |
|---|---|
| PubChem CID | 69353514 |
| Molecular Formula | C38H47N5O3Si |
| Molecular Weight | 649.91 g/mol |
| Exact Mass | 649.34 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-2-[[3-[2-(4,6-dimethyl-2-pyridinyl)ethenyl]-1-(oxan-2-yl)indazol-6-yl]amino]benzamide |
| SMILES | Cc1cc(C)nc(C=Cc2nn(C3CCCCO3)c3cc(Nc4ccccc4C(=O)NCC#CCO[Si](C)(C)C(C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C38H47N5O3Si/c1-27-24-28(2)40-29(25-27)18-20-34-31-19-17-30(26-35(31)43(42-34)36-16-10-12-22-45-36)41-33-15-9-8-14-32(33)37(44)39-21-11-13-23-46-47(6,7)38(3,4)5/h8-9,14-15,17-20,24-26,36,41H,10,12,16,21-23H2,1-7H3,(H,39,44) |
| InChIKey | XLHSOJQLSZYDOL-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.91 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|