C29H32NO3P — CID 69353942
N-(4-diethylphosphoryl-2-methylphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzoxepine-4-carboxamide (PubChem CID 69353942) has the molecular formula C29H32NO3P and a molecular weight of 473.55 g/mol. Its IUPAC name is N-(4-diethylphosphoryl-2-methylphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzoxepine-4-carboxamide.
| Compound Name | N-(4-diethylphosphoryl-2-methylphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzoxepine-4-carboxamide |
|---|---|
| PubChem CID | 69353942 |
| Molecular Formula | C29H32NO3P |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-(4-diethylphosphoryl-2-methylphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzoxepine-4-carboxamide |
| SMILES | CCP(=O)(CC)c1ccc(NC(=O)C2=Cc3cc(-c4ccc(C)cc4)ccc3OCC2)c(C)c1 |
| InChI | InChI=1S/C29H32NO3P/c1-5-34(32,6-2)26-12-13-27(21(4)17-26)30-29(31)24-15-16-33-28-14-11-23(18-25(28)19-24)22-9-7-20(3)8-10-22/h7-14,17-19H,5-6,15-16H2,1-4H3,(H,30,31) |
| InChIKey | MCSNMNJIZKOPBX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|