C25H30N2O6 — CID 69354065
5-[3-[3-(4-morpholin-2-yl-2-propylphenoxy)propoxy]phenyl]-1,3-oxazolidine-2,4-dione (PubChem CID 69354065) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 5-[3-[3-(4-morpholin-2-yl-2-propylphenoxy)propoxy]phenyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[3-[3-(4-morpholin-2-yl-2-propylphenoxy)propoxy]phenyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 69354065 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 5-[3-[3-(4-morpholin-2-yl-2-propylphenoxy)propoxy]phenyl]-1,3-oxazolidine-2,4-dione |
| SMILES | CCCc1cc(C2CNCCO2)ccc1OCCCOc1cccc(C2OC(=O)NC2=O)c1 |
| InChI | InChI=1S/C25H30N2O6/c1-2-5-17-14-18(22-16-26-10-13-32-22)8-9-21(17)31-12-4-11-30-20-7-3-6-19(15-20)23-24(28)27-25(29)33-23/h3,6-9,14-15,22-23,26H,2,4-5,10-13,16H2,1H3,(H,27,28,29) |
| InChIKey | KMDORGJGBOYCII-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|