C18H13F3O5S — CID 69354613
5,6-dimethoxy-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxylic acid (PubChem CID 69354613) has the molecular formula C18H13F3O5S and a molecular weight of 398.36 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5,6-dimethoxy-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 69354613 |
| Molecular Formula | C18H13F3O5S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 5,6-dimethoxy-3-[(2,3,6-trifluorophenyl)methoxy]-1-benzothiophene-2-carboxylic acid |
| SMILES | COc1cc2sc(C(=O)O)c(OCc3c(F)ccc(F)c3F)c2cc1OC |
| InChI | InChI=1S/C18H13F3O5S/c1-24-12-5-8-14(6-13(12)25-2)27-17(18(22)23)16(8)26-7-9-10(19)3-4-11(20)15(9)21/h3-6H,7H2,1-2H3,(H,22,23) |
| InChIKey | BWELMMXPHLHWAO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|