C14H11N3O3S — CID 69354631
5-(2-benzofuran-1-yl)-2-(carbamoylamino)thiophene-3-carboxamide (PubChem CID 69354631) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-(2-benzofuran-1-yl)-2-(carbamoylamino)thiophene-3-carboxamide.
| Compound Name | 5-(2-benzofuran-1-yl)-2-(carbamoylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 69354631 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 5-(2-benzofuran-1-yl)-2-(carbamoylamino)thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(-c2occ3ccccc23)cc1C(N)=O |
| InChI | InChI=1S/C14H11N3O3S/c15-12(18)9-5-10(21-13(9)17-14(16)19)11-8-4-2-1-3-7(8)6-20-11/h1-6H,(H2,15,18)(H3,16,17,19) |
| InChIKey | QBGYBTQAQUYNSR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |