About 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol
3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol (PubChem CID 69354868) has the molecular formula C20H15F2NO3S
and a molecular weight of 387.41 g/mol. Its IUPAC name is 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol.
Molecular Properties
| Compound Name | 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol |
| PubChem CID | 69354868 |
| Molecular Formula | C20H15F2NO3S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol |
| SMILES | C[C@H]1c2cc(F)ccc2-c2ccc(F)cc2N1S(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C20H15F2NO3S/c1-12-19-9-13(21)5-7-17(19)18-8-6-14(22)10-20(18)23(12)27(25,26)16-4-2-3-15(24)11-16/h2-12,24H,1H3/t12-/m0/s1 |
| InChIKey | UTGNZCSSJVPIHM-LBPRGKRZSA-N |
| XLogP | 4.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol?
The IUPAC name of 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol (CID 69354868) is 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol.
What is the SMILES notation for 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol?
The canonical SMILES for 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol is C[C@H]1c2cc(F)ccc2-c2ccc(F)cc2N1S(=O)(=O)c1cccc(O)c1.
What is the InChIKey of 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol?
The InChIKey is UTGNZCSSJVPIHM-LBPRGKRZSA-N. The full InChI is InChI=1S/C20H15F2NO3S/c1-12-19-9-13(21)5-7-17(19)18-8-6-14(22)10-20(18)23(12)27(25,26)16-4-2-3-15(24)11-16/h2-12,24H,1H3/t12-/m0/s1.
What are the key properties of 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol?
3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol has a molecular weight of 387.41 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(6S)-3,8-difluoro-6-methyl-6H-phenanthridin-5-yl]sulfonyl]phenol is sourced from PubChem (CID 69354868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).