About 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine
1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine (PubChem CID 69355727) has the molecular formula C18H32N4
and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine.
Molecular Properties
| Compound Name | 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine |
| PubChem CID | 69355727 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine |
| SMILES | CCCCC=CCN1C(C)=C(C)N=C(N2CCNCC2)C1C |
| InChI | InChI=1S/C18H32N4/c1-5-6-7-8-9-12-22-16(3)15(2)20-18(17(22)4)21-13-10-19-11-14-21/h8-9,17,19H,5-7,10-14H2,1-4H3 |
| InChIKey | UZPJQOGWZWXNON-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine?
The IUPAC name of 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine (CID 69355727) is 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine.
What is the SMILES notation for 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine?
The canonical SMILES for 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine is CCCCC=CCN1C(C)=C(C)N=C(N2CCNCC2)C1C.
What is the InChIKey of 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine?
The InChIKey is UZPJQOGWZWXNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4/c1-5-6-7-8-9-12-22-16(3)15(2)20-18(17(22)4)21-13-10-19-11-14-21/h8-9,17,19H,5-7,10-14H2,1-4H3.
What are the key properties of 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine?
1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine has a molecular weight of 304.48 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hept-2-enyl-2,5,6-trimethyl-3-piperazin-1-yl-2H-pyrazine is sourced from PubChem (CID 69355727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).