C18H14F3NO — CID 69355757
1-[1-(3,5-dimethylphenyl)indol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 69355757) has the molecular formula C18H14F3NO and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-[1-(3,5-dimethylphenyl)indol-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-(3,5-dimethylphenyl)indol-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 69355757 |
| Molecular Formula | C18H14F3NO |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-[1-(3,5-dimethylphenyl)indol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | Cc1cc(C)cc(-n2cc(C(=O)C(F)(F)F)c3ccccc32)c1 |
| InChI | InChI=1S/C18H14F3NO/c1-11-7-12(2)9-13(8-11)22-10-15(17(23)18(19,20)21)14-5-3-4-6-16(14)22/h3-10H,1-2H3 |
| InChIKey | RMYJDXCSUICKQQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |