About (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine
(3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine (PubChem CID 69355796) has the molecular formula C28H34N2O
and a molecular weight of 414.59 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine.
Molecular Properties
| Compound Name | (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine |
| PubChem CID | 69355796 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine |
| SMILES | C[C@@H]1CN(CCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](C)N1 |
| InChI | InChI=1S/C28H34N2O/c1-23-21-30(22-24(2)29-23)19-12-20-31-28(25-13-6-3-7-14-25,26-15-8-4-9-16-26)27-17-10-5-11-18-27/h3-11,13-18,23-24,29H,12,19-22H2,1-2H3/t23-,24+ |
| InChIKey | XXFDXXOWHCFVSP-PSWAGMNNSA-N |
| XLogP | 5.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine?
The IUPAC name of (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine (CID 69355796) is (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine.
What is the SMILES notation for (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine?
The canonical SMILES for (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine is C[C@@H]1CN(CCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](C)N1.
What is the InChIKey of (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine?
The InChIKey is XXFDXXOWHCFVSP-PSWAGMNNSA-N. The full InChI is InChI=1S/C28H34N2O/c1-23-21-30(22-24(2)29-23)19-12-20-31-28(25-13-6-3-7-14-25,26-15-8-4-9-16-26)27-17-10-5-11-18-27/h3-11,13-18,23-24,29H,12,19-22H2,1-2H3/t23-,24+.
What are the key properties of (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine?
(3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine has a molecular weight of 414.59 g/mol, XLogP of 5.07, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3,5-dimethyl-1-(3-trityloxypropyl)piperazine is sourced from PubChem (CID 69355796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).