About 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one
1-phenyl-3-propyl-3,4-dihydroquinolin-2-one (PubChem CID 69356082) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 69356082 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one |
| SMILES | CCCC1Cc2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H19NO/c1-2-8-15-13-14-9-6-7-12-17(14)19(18(15)20)16-10-4-3-5-11-16/h3-7,9-12,15H,2,8,13H2,1H3 |
| InChIKey | BQADFTWQBNIZFR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one (CID 69356082) is 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one is CCCC1Cc2ccccc2N(c2ccccc2)C1=O.
What is the InChIKey of 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one?
The InChIKey is BQADFTWQBNIZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO/c1-2-8-15-13-14-9-6-7-12-17(14)19(18(15)20)16-10-4-3-5-11-16/h3-7,9-12,15H,2,8,13H2,1H3.
What are the key properties of 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one?
1-phenyl-3-propyl-3,4-dihydroquinolin-2-one has a molecular weight of 265.36 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-propyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 69356082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).