C27H34FN3O2 — CID 69356350
N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-2-(4-fluorophenyl)imidazol-4-yl]methyl]pentan-1-amine (PubChem CID 69356350) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-2-(4-fluorophenyl)imidazol-4-yl]methyl]pentan-1-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-2-(4-fluorophenyl)imidazol-4-yl]methyl]pentan-1-amine |
|---|---|
| PubChem CID | 69356350 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-[[3-butyl-2-(4-fluorophenyl)imidazol-4-yl]methyl]pentan-1-amine |
| SMILES | CCCCCN(Cc1ccc2c(c1)OCO2)Cc1cnc(-c2ccc(F)cc2)n1CCCC |
| InChI | InChI=1S/C27H34FN3O2/c1-3-5-7-14-30(18-21-8-13-25-26(16-21)33-20-32-25)19-24-17-29-27(31(24)15-6-4-2)22-9-11-23(28)12-10-22/h8-13,16-17H,3-7,14-15,18-20H2,1-2H3 |
| InChIKey | DKZOKOLKHBVJNT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|