About 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine
3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine (PubChem CID 69356502) has the molecular formula C19H27BrN2O2
and a molecular weight of 395.34 g/mol. Its IUPAC name is 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine |
| PubChem CID | 69356502 |
| Molecular Formula | C19H27BrN2O2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine |
| SMILES | C1CCN(CC2CCCN2)CC1.O=C(O)C=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H20N2.C9H7BrO2/c1-2-7-12(8-3-1)9-10-5-4-6-11-10;10-8-4-1-7(2-5-8)3-6-9(11)12/h10-11H,1-9H2;1-6H,(H,11,12) |
| InChIKey | PLHROWMFRYQWFM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine?
The IUPAC name of 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine (CID 69356502) is 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine.
What is the SMILES notation for 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine?
The canonical SMILES for 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine is C1CCN(CC2CCCN2)CC1.O=C(O)C=Cc1ccc(Br)cc1.
What is the InChIKey of 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine?
The InChIKey is PLHROWMFRYQWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.C9H7BrO2/c1-2-7-12(8-3-1)9-10-5-4-6-11-10;10-8-4-1-7(2-5-8)3-6-9(11)12/h10-11H,1-9H2;1-6H,(H,11,12).
What are the key properties of 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine?
3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine has a molecular weight of 395.34 g/mol, XLogP of 3.77, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)prop-2-enoic acid;1-(pyrrolidin-2-ylmethyl)piperidine is sourced from PubChem (CID 69356502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).