About methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate
methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate (PubChem CID 69356670) has the molecular formula C16H23NO5S
and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate |
| PubChem CID | 69356670 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate |
| SMILES | C/C=C/c1cc(C(=O)OC)cc(N2CCCCS2(O)O)c1OC |
| InChI | InChI=1S/C16H23NO5S/c1-4-7-12-10-13(16(18)22-3)11-14(15(12)21-2)17-8-5-6-9-23(17,19)20/h4,7,10-11,19-20H,5-6,8-9H2,1-3H3/b7-4+ |
| InChIKey | BPDPFOAXBNXCAC-QPJJXVBHSA-N |
| XLogP | 3.78 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate?
The IUPAC name of methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate (CID 69356670) is methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate.
What is the SMILES notation for methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate?
The canonical SMILES for methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate is C/C=C/c1cc(C(=O)OC)cc(N2CCCCS2(O)O)c1OC.
What is the InChIKey of methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate?
The InChIKey is BPDPFOAXBNXCAC-QPJJXVBHSA-N. The full InChI is InChI=1S/C16H23NO5S/c1-4-7-12-10-13(16(18)22-3)11-14(15(12)21-2)17-8-5-6-9-23(17,19)20/h4,7,10-11,19-20H,5-6,8-9H2,1-3H3/b7-4+.
What are the key properties of methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate?
methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate has a molecular weight of 341.43 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,1-dihydroxythiazinan-2-yl)-4-methoxy-5-[(E)-prop-1-enyl]benzoate is sourced from PubChem (CID 69356670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).