C31H48N4O4S — CID 69357208
N-[(2S,3R)-4-(2,6-dimethylheptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide (PubChem CID 69357208) has the molecular formula C31H48N4O4S and a molecular weight of 572.82 g/mol. Its IUPAC name is N-[(2S,3R)-4-(2,6-dimethylheptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide.
| Compound Name | N-[(2S,3R)-4-(2,6-dimethylheptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide |
|---|---|
| PubChem CID | 69357208 |
| Molecular Formula | C31H48N4O4S |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | N-[(2S,3R)-4-(2,6-dimethylheptan-2-ylamino)-3-hydroxy-1-phenylbutan-2-yl]-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-5-(ethylamino)benzamide |
| SMILES | CCNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNC(C)(C)CCCC(C)C)cc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C31H48N4O4S/c1-6-32-26-19-25(20-27(21-26)35-16-11-17-40(35,38)39)30(37)34-28(18-24-13-8-7-9-14-24)29(36)22-33-31(4,5)15-10-12-23(2)3/h7-9,13-14,19-21,23,28-29,32-33,36H,6,10-12,15-18,22H2,1-5H3,(H,34,37)/t28-,29+/m0/s1 |
| InChIKey | BPJPAMRGQLPTLT-URLMMPGGSA-N |
| XLogP | 4.55 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |