C16H12NO2S- — CID 6935797
(2R)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylate (PubChem CID 6935797) has the molecular formula C16H12NO2S- and a molecular weight of 282.34 g/mol. Its IUPAC name is (2R)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylate.
| Compound Name | (2R)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylate |
|---|---|
| PubChem CID | 6935797 |
| Molecular Formula | C16H12NO2S- |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (2R)-4-phenyl-2,3-dihydro-1,5-benzothiazepine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CC(c2ccccc2)=Nc2ccccc2S1 |
| InChI | InChI=1S/C16H13NO2S/c18-16(19)15-10-13(11-6-2-1-3-7-11)17-12-8-4-5-9-14(12)20-15/h1-9,15H,10H2,(H,18,19)/p-1/t15-/m1/s1 |
| InChIKey | BUHNCRFGISFTRP-OAHLLOKOSA-M |
| XLogP | 2.42 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |