C14H19F2N3O — CID 69357979
(9R,13R)-4-(difluoromethyl)-5-(methoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene (PubChem CID 69357979) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is (9R,13R)-4-(difluoromethyl)-5-(methoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene.
| Compound Name | (9R,13R)-4-(difluoromethyl)-5-(methoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 69357979 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (9R,13R)-4-(difluoromethyl)-5-(methoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
| SMILES | COCc1cc2c(nc1C(F)F)N1[C@@H](CNC[C@H]1C)C2 |
| InChI | InChI=1S/C14H19F2N3O/c1-8-5-17-6-11-4-9-3-10(7-20-2)12(13(15)16)18-14(9)19(8)11/h3,8,11,13,17H,4-7H2,1-2H3/t8-,11-/m1/s1 |
| InChIKey | AUQWNSQKWQWYKG-LDYMZIIASA-N |
| XLogP | 1.89 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |