C20H29F2N3O3 — CID 69358054
tert-butyl (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate (PubChem CID 69358054) has the molecular formula C20H29F2N3O3 and a molecular weight of 397.47 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 69358054 |
| Molecular Formula | C20H29F2N3O3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | tert-butyl (9R,13R)-4-(difluoromethyl)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
| SMILES | CCOCc1cc2c(nc1C(F)F)N1[C@H](C2)CN(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C20H29F2N3O3/c1-6-27-11-14-7-13-8-15-10-24(19(26)28-20(3,4)5)9-12(2)25(15)18(13)23-16(14)17(21)22/h7,12,15,17H,6,8-11H2,1-5H3/t12-,15-/m1/s1 |
| InChIKey | KXTHMTMJFDIZQC-IUODEOHRSA-N |
| XLogP | 3.93 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |