C16H32N4O3S — CID 69358248
1-[3-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]propyl]piperidine-4-carboxamide (PubChem CID 69358248) has the molecular formula C16H32N4O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is 1-[3-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 69358248 |
| Molecular Formula | C16H32N4O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[3-[methyl-(1-methylpiperidin-4-yl)sulfamoyl]propyl]piperidine-4-carboxamide |
| SMILES | CN1CCC(N(C)S(=O)(=O)CCCN2CCC(C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C16H32N4O3S/c1-18-9-6-15(7-10-18)19(2)24(22,23)13-3-8-20-11-4-14(5-12-20)16(17)21/h14-15H,3-13H2,1-2H3,(H2,17,21) |
| InChIKey | XWAFLFOSBMOZOB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |